Online Database of Chemicals from Around the World
|
CAS#: 38777-13-8 Product: (2-Propan-2-Yloxyphenyl) N-Methyl-N-Nitrosocarbamate No suppilers available for the product. |
| Name | (2-Propan-2-Yloxyphenyl) N-Methyl-N-Nitrosocarbamate |
|---|---|
| Synonyms | (2-Isopropoxyphenyl) N-Methyl-N-Nitroso-Carbamate; N-Methyl-N-Nitrosocarbamic Acid (2-Isopropoxyphenyl) Ester; N-Methyl-N-Nitroso-Carbamic Acid (2-Isopropoxyphenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 38777-13-8 |
| SMILES | C1=C(OC(C)C)C(=CC=C1)OC(=O)N(C)N=O |
| InChI | 1S/C11H14N2O4/c1-8(2)16-9-6-4-5-7-10(9)17-11(14)13(3)12-15/h4-8H,1-3H3 |
| InChIKey | LYVDQJOFFUOJJT-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.896°C at 760 mmHg (Cal.) |
| Flash point | 146.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Propan-2-Yloxyphenyl) N-Methyl-N-Nitrosocarbamate |