Online Database of Chemicals from Around the World
| Name | 4-Fluorobenzo[a]Anthracene |
|---|---|
| Synonyms | 4-05-00-02551 (Beilstein Handbook Reference); 4-Fluorobenz(A)Anthracene; 4-Fluorobenzanthracene |
| Molecular Structure | ![CAS#: 388-72-7， 4-Fluorobenzo[a]Anthracene](/moreStructures/388-72-7.gif) |
| Molecular Formula | C18H11F |
| Molecular Weight | 246.28 |
| CAS Registry Number | 388-72-7 |
| SMILES | C2=C1C4=C(C=CC1=CC3=CC=CC=C23)C(=CC=C4)F |
| InChI | 1S/C18H11F/c19-18-7-3-6-15-16(18)9-8-14-10-12-4-1-2-5-13(12)11-17(14)15/h1-11H |
| InChIKey | NHEMFXZWMPLBQU-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.746°C at 760 mmHg (Cal.) |
| Flash point | 185.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluorobenzo[a]Anthracene |
