Online Database of Chemicals from Around the World
|
CAS#: 38818-67-6 Product: (3alpha)-12,13-Epoxy-Trichothec-9-Ene-3,15-Diol No suppilers available for the product. |
| Name | (3alpha)-12,13-Epoxy-Trichothec-9-Ene-3,15-Diol |
|---|---|
| Synonyms | 3,15-Dideacetylcalonectrin; 3,15-Didesacetylcalonectrin; 3,15-Dihydroxy-12,13-Epoxytrichothec-9-Ene |
| Molecular Structure |  |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 38818-67-6 |
| SMILES | [C@@]12(OC1)[C@]3([C@@]4([C@H](O[C@@H]2[C@H](O)C3)C=C(CC4)C)CO)C |
| InChI | 1S/C15H22O4/c1-9-3-4-14(7-16)11(5-9)19-12-10(17)6-13(14,2)15(12)8-18-15/h5,10-12,16-17H,3-4,6-8H2,1-2H3/t10-,11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | NBRKAFIHDFEBCP-OJVARPOJSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.96°C at 760 mmHg (Cal.) |
| Flash point | 208.389°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3alpha)-12,13-Epoxy-Trichothec-9-Ene-3,15-Diol |