Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dilithium Azelate |
|---|---|
| Synonyms | Dilithium Azelaate; Dilithium Azelate |
| Molecular Structure |  |
| Molecular Formula | C9H14Li2O4 |
| Molecular Weight | 200.09 |
| CAS Registry Number | 38900-29-7 |
| EINECS | 254-184-4 |
| SMILES | C(C([O-])=O)CCCCCCC([O-])=O.[Li+].[Li+] |
| InChI | 1S/C9H16O4.2Li/c10-8(11)6-4-2-1-3-5-7-9(12)13;;/h1-7H2,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | KCEQQLDYFGMIGU-UHFFFAOYSA-L |
| Boiling point | 370.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dilithium Azelate |