Online Database of Chemicals from Around the World
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (71) 858-2020 | |||
 |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | 2,8-Dichlorooxanthrene |
|---|---|
| Synonyms | 2,8-Dichlorodibenzo-P-Dioxin; 2,8-Dichlorodibenzo-4-Dioxin; 2,8-Dichlorodibenzo-Para-Dioxin |
| Molecular Structure |  |
| Molecular Formula | C12H6Cl2O2 |
| Molecular Weight | 253.08 |
| CAS Registry Number | 38964-22-6 |
| SMILES | C1=C(C=CC3=C1OC2=CC(=CC=C2O3)Cl)Cl |
| InChI | 1S/C12H6Cl2O2/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9/h1-6H |
| InChIKey | WMWJCKBJUQDYLM-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.172°C at 760 mmHg (Cal.) |
| Flash point | 140.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,8-Dichlorooxanthrene |