Online Database of Chemicals from Around the World
|
CAS#: 39011-86-4 Product: 4-[(Z)-4-(4-Hydroxyphenyl)Hex-4-En-3-Yl]Phenol No suppilers available for the product. |
| Name | 4-[(Z)-4-(4-Hydroxyphenyl)Hex-4-En-3-Yl]Phenol |
|---|---|
| Synonyms | 4-[(Z)-1-Ethyl-2-(4-Hydroxyphenyl)But-2-Enyl]Phenol; Phenol, 4,4'-(1-Ethyl-2-Ethylidene-1,2-Ethanediyl)Bis-; Pseudo-Des |
| Molecular Structure | ![CAS#: 39011-86-4， 4-[(Z)-4-(4-Hydroxyphenyl)Hex-4-En-3-Yl]Phenol](/moreStructures/39011-86-4.gif) |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35 |
| CAS Registry Number | 39011-86-4 |
| SMILES | C2=C(\C(C(C1=CC=C(O)C=C1)CC)=C/C)C=CC(=C2)O |
| InChI | 1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h3,5-12,18-20H,4H2,1-2H3/b17-3+ |
| InChIKey | CEHDRGBLVBQUPH-IJUHEHPCSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.303°C at 760 mmHg (Cal.) |
| Flash point | 187.06°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(Z)-4-(4-Hydroxyphenyl)Hex-4-En-3-Yl]Phenol |