Online Database of Chemicals from Around the World
| Name | 5-Amino-2-Anilinobenzoic Acid |
|---|---|
| Synonyms | 2,5-Diaminobenzoic acid, N(2)-phenyl-; 5-Amino-2-anilinobenzoic acid; 5-Amino-2-anilinobenzoic acid # |
| Molecular Structure |  |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 |
| CAS Registry Number | 39053-07-1 |
| SMILES | O=C(O)c2cc(ccc2Nc1ccccc1)N |
| InChI | 1S/C13H12N2O2/c14-9-6-7-12(11(8-9)13(16)17)15-10-4-2-1-3-5-10/h1-8,15H,14H2,(H,16,17) |
| InChIKey | YKWIACXPBYJNGR-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.384°C at 760 mmHg (Cal.) |
| Flash point | 220.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-2-Anilinobenzoic Acid |
