Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 7,8,9,10-Tetrahydro-Benzo[b]Naphtho[2,3-d]Thiophene |
|---|---|
| Synonyms | 7,8,9,10-Tetrahydronaphtho[6,7-B]Benzothiophene; Benzo[B]Naphtho[2,3-D]Thiophene, 7,8,9,10-Tetrahydro-; Nsc33397 |
| Molecular Structure | ![CAS#: 39097-15-9， 7,8,9,10-Tetrahydro-Benzo[b]Naphtho[2,3-d]Thiophene](/moreStructures/39097-15-9.gif) |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.35 |
| CAS Registry Number | 39097-15-9 |
| SMILES | C1=CC2=C(C=C1)SC3=C2C=C4C(=C3)CCCC4 |
| InChI | 1S/C16H14S/c1-2-6-12-10-16-14(9-11(12)5-1)13-7-3-4-8-15(13)17-16/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | PHIITTUHUJODBZ-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.653°C at 760 mmHg (Cal.) |
| Flash point | 155.608°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,10-Tetrahydro-Benzo[b]Naphtho[2,3-d]Thiophene |