|
CAS#: 392-86-9 Product: 2-Aminobenzenesulfonyl Fluoride No suppilers available for the product. |
| Name | 2-Aminobenzenesulfonyl Fluoride |
|---|---|
| Synonyms | 2-Aminobenzene Sulfonyl Fluoride; Benzenesulfonyl Fluoride, 2-Amino-; Benzenesulfonyl Fluoride, O-Amino- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6FNO2S |
| Molecular Weight | 175.18 |
| CAS Registry Number | 392-86-9 |
| EINECS | 206-882-5 |
| SMILES | C1=C(C(=CC=C1)N)[S](=O)(=O)F |
| InChI | 1S/C6H6FNO2S/c7-11(9,10)6-4-2-1-3-5(6)8/h1-4H,8H2 |
| InChIKey | OYJFEOGFHBNHRT-UHFFFAOYSA-N |
| Density | 1.431g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.555°C at 760 mmHg (Cal.) |
| Flash point | 121.661°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Aminobenzenesulfonyl Fluoride |