Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 5-Bromo-1,2-Dichloro-3-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | Benzene, 5-bromo-1,2-dichloro-3-(trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C7H2BrCl2F3 |
| Molecular Weight | 293.90 |
| CAS Registry Number | 392-89-2 |
| SMILES | c1c(cc(c(c1C(F)(F)F)Cl)Cl)Br |
| InChI | 1S/C7H2BrCl2F3/c8-3-1-4(7(11,12)13)6(10)5(9)2-3/h1-2H |
| InChIKey | HMRZLMAZFSEQBN-UHFFFAOYSA-N |
| Density | 1.803g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.163°C at 760 mmHg (Cal.) |
| Flash point | 88.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-1,2-Dichloro-3-(Trifluoromethyl)Benzene |