| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Name | 3,5-Dinitro-4-fluorobenzotrifluoride |
|---|---|
| Synonyms | 2-fluoro-1,3-dinitro-5-(trifluoromethyl)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C7H2F4N2O4 |
| Molecular Weight | 254.10 |
| CAS Registry Number | 393-76-0 |
| EC Number | 670-819-1 |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)[N+](=O)[O-])C(F)(F)F |
| Solubility | 37.75 mg/L (25 °C water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.499, Calc.* |
| Melting point | 82.94 °C |
| Boiling Point | 291.35 °C, 262.7±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 112.7±25.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H301-H311-H315-H319-H335 Details | ||||||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P316-P302+P352-P304+P340-P305+P351+P338-P316-P319-P321-P330-P332+P317-P337+P317-P361+P364-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 3,5-Dinitro-4-fluorobenzotrifluoride |