| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Hexyl-5-Propylbenzene-1,3-Diol |
|---|---|
| Synonyms | 2-Hexyl-5-Propyl-Benzene-1,3-Diol; 2-Hexyl-5-Propyl-Resorcinol; 1,3-Benzenediol, 2-Hexyl-5-Propyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 |
| CAS Registry Number | 39341-78-1 |
| SMILES | C1=C(C=C(C(=C1O)CCCCCC)O)CCC |
| InChI | 1S/C15H24O2/c1-3-5-6-7-9-13-14(16)10-12(8-4-2)11-15(13)17/h10-11,16-17H,3-9H2,1-2H3 |
| InChIKey | VERGPVBZPMTZDY-UHFFFAOYSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.157°C at 760 mmHg (Cal.) |
| Flash point | 174.377°C (Cal.) |
| (1) | Harald Gross and Joyce E. Loper. Genomics of secondary metabolite production by Pseudomonas spp., Nat. Prod. Rep., 2009, 26, 1408. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Hexyl-5-Propylbenzene-1,3-Diol |