| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Phenamacril |
|---|---|
| Synonyms | Ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 39491-78-6 |
| SMILES | CCOC(=O)/C(=C(/C1=CC=CC=C1)N)/C#N |
| Solubility | 8056 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.564, Calc.* |
| Melting point | 108.42 °C |
| Boiling Point | 356.86 °C, 440.6±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 220.3±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302+H312+H332-H315-H319-H317-H335-H412 Details |
| Safety Statements | P261-P280-P305+P351+P338-P321-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Phenamacril |