Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,6-Dimethyl-1H-Benzimidazole 3-Oxide |
|---|---|
| Synonyms | 1,6-dimethyl-1H-benzo[d]imidazole 3-oxide |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 |
| CAS Registry Number | 39705-18-5 |
| SMILES | Cc1ccc2c(c1)n(c[n+]2[O-])C |
| InChI | 1S/C9H10N2O/c1-7-3-4-8-9(5-7)10(2)6-11(8)12/h3-6H,1-2H3 |
| InChIKey | BNMYFFFQYCZFCW-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.211°C at 760 mmHg (Cal.) |
| Flash point | 149.878°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dimethyl-1H-Benzimidazole 3-Oxide |