|
CAS#: 39853-58-2 Product: 2,2-Dimethyl-2,3-Dihydro-1H-Phenothiazin-4(10H)-One No suppilers available for the product. |
| Name | 2,2-Dimethyl-2,3-Dihydro-1H-Phenothiazin-4(10H)-One |
|---|---|
| Synonyms | 2,2-dimethyl-1,2,3-trihydrophenothiazin-4-one; 2,2-Dimethyl-2,3-dihydro-1H,10H-phenothiazin-4-one; 2,2-Dimethyl-2,3-dihydro-1H-phenothiazin-4(10H)-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.34 |
| CAS Registry Number | 39853-58-2 |
| SMILES | CC2(C)CC=1Nc3ccccc3SC=1C(=O)C2 |
| InChI | 1S/C14H15NOS/c1-14(2)7-10-13(11(16)8-14)17-12-6-4-3-5-9(12)15-10/h3-6,15H,7-8H2,1-2H3 |
| InChIKey | KVFVBTRWHZAXNS-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.573°C at 760 mmHg (Cal.) |
| Flash point | 172.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-2,3-Dihydro-1H-Phenothiazin-4(10H)-One |