Online Database of Chemicals from Around the World
| Name | 1-(5-Nitrothiazol-2-Yl)Imidazolidine-2-Thione |
|---|---|
| Synonyms | 1-(5-Nitrothiazol-2-Yl)Imidazolidine-2-Thione; 1-(5-Nitro-2-Thiazolyl)-2-Imidazolidinethione |
| Molecular Structure |  |
| Molecular Formula | C6H6N4O2S2 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 40016-42-0 |
| EINECS | 254-750-0 |
| SMILES | C1=C([N+]([O-])=O)SC(=N1)N2CCNC2=S |
| InChI | 1S/C6H6N4O2S2/c11-10(12)4-3-8-6(14-4)9-2-1-7-5(9)13/h3H,1-2H2,(H,7,13) |
| InChIKey | ZOFIQVOGCZRBNP-UHFFFAOYSA-N |
| Density | 1.705g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.708°C at 760 mmHg (Cal.) |
| Flash point | 192.513°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(5-Nitrothiazol-2-Yl)Imidazolidine-2-Thione |
