Online Database of Chemicals from Around the World
|
CAS#: 40360-71-2 Product: Anhydrolycorinone No suppilers available for the product. |
| Name | Anhydrolycorinone |
|---|---|
| Synonyms | C12250; Nsc276737 |
| Molecular Structure |  |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 |
| CAS Registry Number | 40360-71-2 |
| SMILES | C3=C2C(N5C1=C(C=CC=C1C2=CC4=C3OCO4)CC5)=O |
| InChI | 1S/C16H11NO3/c18-16-12-7-14-13(19-8-20-14)6-11(12)10-3-1-2-9-4-5-17(16)15(9)10/h1-3,6-7H,4-5,8H2 |
| InChIKey | UJOHABFHKQHIKS-UHFFFAOYSA-N |
| Density | 1.532g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.755°C at 760 mmHg (Cal.) |
| Flash point | 271.162°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Anhydrolycorinone |