|
CAS#: 403848-01-1 Product: (4S,6S)-N-Ethyl-6-Methyl-5,6-Dihydro-4H-Thieno[2,3-b]Thiopyran-4-Amine 7,7-Dioxide No suppilers available for the product. |
| Name | (4S,6S)-N-Ethyl-6-Methyl-5,6-Dihydro-4H-Thieno[2,3-b]Thiopyran-4-Amine 7,7-Dioxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.36 |
| CAS Registry Number | 403848-01-1 |
| SMILES | O=S2(=O)c1sccc1[C@@H](NCC)C[C@@H]2C |
| InChI | 1S/C10H15NO2S2/c1-3-11-9-6-7(2)15(12,13)10-8(9)4-5-14-10/h4-5,7,9,11H,3,6H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | CSXRPEGBUGCAHV-CBAPKCEASA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.628°C at 760 mmHg (Cal.) |
| Flash point | 199.722°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4S,6S)-N-Ethyl-6-Methyl-5,6-Dihydro-4H-Thieno[2,3-b]Thiopyran-4-Amine 7,7-Dioxide |