Online Database of Chemicals from Around the World
| Name | N-(4-Chlorophenyl)-2-Fluoroacetamide |
|---|---|
| Synonyms | N-(4-Chlorophenyl)-2-Fluoro-Acetamide; N-(4-Chlorophenyl)-2-Fluoro-Ethanamide; 4'-Chloro-2-Fluoroacetanilide |
| Molecular Structure |  |
| Molecular Formula | C8H7ClFNO |
| Molecular Weight | 187.60 |
| CAS Registry Number | 404-41-1 |
| SMILES | C1=C(NC(CF)=O)C=CC(=C1)Cl |
| InChI | 1S/C8H7ClFNO/c9-6-1-3-7(4-2-6)11-8(12)5-10/h1-4H,5H2,(H,11,12) |
| InChIKey | UOJROUJTMBCWCR-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.322°C at 760 mmHg (Cal.) |
| Flash point | 163.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Chlorophenyl)-2-Fluoroacetamide |
