| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Name | 1-{Bis[(Trifluoromethyl)Sulfonyl]Methyl}-2,3,4,5,6-Pentafluorobenzene |
|---|---|
| Synonyms | 1-(Bis-tr |
| Molecular Structure | ![]() |
| Molecular Formula | C9HF11O4S2 |
| Molecular Weight | 446.21 |
| CAS Registry Number | 405074-81-9 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | 1S/C9HF11O4S2/c10-2-1(3(11)5(13)6(14)4(2)12)7(25(21,22)8(15,16)17)26(23,24)9(18,19)20/h7H |
| InChIKey | RLLDXJXYMKTGPV-UHFFFAOYSA-N |
| Density | 1.896g/cm3 (Cal.) |
|---|---|
| Melting point | 89°C (Expl.) |
| Boiling point | 381.965°C at 760 mmHg (Cal.) |
| Flash point | 184.806°C (Cal.) |
| Refractive index | 1.42 (Cal.) |
| (1) | Cheol Hong Cheon and Hisashi Yamamoto. Super Brønsted acid catalysis, Chem. Commun., 2011, 47, 3043. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-{Bis[(Trifluoromethyl)Sulfonyl]Methyl}-2,3,4,5,6-Pentafluorobenzene |