|
CAS#: 40594-65-8 Product: 5-Methyl-2-(Isopropyl)Cyclohexyl Nicotinate No suppilers available for the product. |
| Name | 5-Methyl-2-(Isopropyl)Cyclohexyl Nicotinate |
|---|---|
| Synonyms | (2-Isopropyl-5-Methyl-Cyclohexyl) Pyridine-3-Carboxylate; 3-Pyridinecarboxylic Acid (2-Isopropyl-5-Methylcyclohexyl) Ester; Nicotinic Acid (2-Isopropyl-5-Methyl-Cyclohexyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 |
| CAS Registry Number | 40594-65-8 |
| EINECS | 254-991-1 |
| SMILES | C2=C(C(OC1C(CCC(C1)C)C(C)C)=O)C=NC=C2 |
| InChI | 1S/C16H23NO2/c1-11(2)14-7-6-12(3)9-15(14)19-16(18)13-5-4-8-17-10-13/h4-5,8,10-12,14-15H,6-7,9H2,1-3H3 |
| InChIKey | GGOHHUHCISYDOX-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.138°C at 760 mmHg (Cal.) |
| Flash point | 163.744°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-(Isopropyl)Cyclohexyl Nicotinate |