Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Dichloro[(1R,2R)-2-Methylcyclopentyl]Borane |
|---|---|
| Synonyms | dichloro((1R,2R)-2-methylcyclopentyl)borane |
| Molecular Structure | ![CAS#: 40649-18-1， Dichloro[(1R,2R)-2-Methylcyclopentyl]Borane](/moreStructures/40649-18-1.gif) |
| Molecular Formula | C6H11BCl2 |
| Molecular Weight | 164.87 |
| CAS Registry Number | 40649-18-1 |
| SMILES | B([C@@H]1CCC[C@H]1C)(Cl)Cl |
| InChI | 1S/C6H11BCl2/c1-5-3-2-4-6(5)7(8)9/h5-6H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | LERAWFKJKSEXJT-PHDIDXHHSA-N |
| Density | 1.059g/cm3 (Cal.) |
|---|---|
| Boiling point | 177.184°C at 760 mmHg (Cal.) |
| Flash point | 60.959°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloro[(1R,2R)-2-Methylcyclopentyl]Borane |