Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2,4-Trimethylquinolin-6-One |
|---|---|
| Synonyms | 2,2,4-Trimethyl-6-Quinolinone; 2,2,4-Trimethyl-6(2H)-Quinolone; 6(2H)-Quinolone, 2,2,4-Trimethyl- |
| Molecular Structure |  |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| CAS Registry Number | 4071-18-5 |
| SMILES | CC2(N=C1C(=CC(=O)C=C1)C(=C2)C)C |
| InChI | 1S/C12H13NO/c1-8-7-12(2,3)13-11-5-4-9(14)6-10(8)11/h4-7H,1-3H3 |
| InChIKey | JPOWOWQYHLDQDB-UHFFFAOYSA-N |
| Density | 1.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.229°C at 760 mmHg (Cal.) |
| Flash point | 115.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4-Trimethylquinolin-6-One |