Online Database of Chemicals from Around the World
|
CAS#: 4072-08-6 Product: 2-Hydroxy-3-Methylbenzophenone No suppilers available for the product. |
| Name | 2-Hydroxy-3-Methylbenzophenone |
|---|---|
| Synonyms | (2-Hydroxy-3-Methyl-Phenyl)-Phenyl-Methanone; 2-Hydroxy-3-Methylbenzophenone |
| Molecular Structure |  |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 |
| CAS Registry Number | 4072-08-6 |
| EINECS | 223-784-8 |
| SMILES | C1=CC=C(C(=C1C(C2=CC=CC=C2)=O)O)C |
| InChI | 1S/C14H12O2/c1-10-6-5-9-12(13(10)15)14(16)11-7-3-2-4-8-11/h2-9,15H,1H3 |
| InChIKey | CMPDALZGFSCNOU-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.571°C at 760 mmHg (Cal.) |
| Flash point | 142.71°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-3-Methylbenzophenone |