Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Fluoro-1-(4-Nitrophenyl)Ethanol |
|---|---|
| Synonyms | 2-fluoro-1-(4-nitrophenyl)ethanol |
| Molecular Structure |  |
| Molecular Formula | C8H8FNO3 |
| Molecular Weight | 185.15 |
| CAS Registry Number | 40733-89-9 |
| SMILES | c1cc(ccc1C(CF)O)[N+](=O)[O-] |
| InChI | 1S/C8H8FNO3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4,8,11H,5H2 |
| InChIKey | ALYBAZKHBOZEHB-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.475°C at 760 mmHg (Cal.) |
| Flash point | 160.319°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-1-(4-Nitrophenyl)Ethanol |