|
CAS#: 4075-12-1 Product: 1,4,6-Androstatrien-3-One-17 beta-Ol No suppilers available for the product. |
| Name | 1,4,6-Androstatrien-3-One-17 beta-Ol |
|---|---|
| Synonyms | (17Beta)-17-Hydroxyandrosta-1,4,6-Trien-3-One; 1,4,6-Androstatrien-3-One-17Beta-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 |
| CAS Registry Number | 4075-12-1 |
| SMILES | [C@H]23[C@@H]([C@@]1(C(=CC(=O)C=C1)C=C2)C)CC[C@]4([C@H]3CC[C@@H]4O)C |
| InChI | 1S/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-17,21H,5-6,8,10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | WGFQJPRCLLMHRT-DYKIIFRCSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.723°C at 760 mmHg (Cal.) |
| Flash point | 193.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,6-Androstatrien-3-One-17 beta-Ol |