Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Cyclopropyl-2-Nitrobenzoic Acid |
|---|---|
| Synonyms | 3-cyclopropyl-2-nitrobenzoic acid |
| Molecular Structure |  |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 |
| CAS Registry Number | 408359-61-5 |
| SMILES | c1cc(c(c(c1)C(=O)O)[N+](=O)[O-])C2CC2 |
| InChI | 1S/C10H9NO4/c12-10(13)8-3-1-2-7(6-4-5-6)9(8)11(14)15/h1-3,6H,4-5H2,(H,12,13) |
| InChIKey | RYQCJNNQJAYVKM-UHFFFAOYSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.331°C at 760 mmHg (Cal.) |
| Flash point | 161.366°C (Cal.) |
| Refractive index | 1.651 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclopropyl-2-Nitrobenzoic Acid |