Online Database of Chemicals from Around the World
|
CAS#: 4084-34-8 Product: 4-(Dichloromethylsilyl)Butyryl Chloride No suppilers available for the product. |
| Name | 4-(Dichloromethylsilyl)Butyryl Chloride |
|---|---|
| Synonyms | 4-(Dichloro-Methyl-Silyl)Butanoyl Chloride; 4-(Dichloro-Methyl-Silyl)Butyryl Chloride; 4-(Methyldichlorosilyl)Butyryl Chloride |
| Molecular Structure |  |
| Molecular Formula | C5H9Cl3OSi |
| Molecular Weight | 219.57 |
| CAS Registry Number | 4084-34-8 |
| EINECS | 223-811-3 |
| SMILES | C([Si](C)(Cl)Cl)CCC(=O)Cl |
| InChI | 1S/C5H9Cl3OSi/c1-10(7,8)4-2-3-5(6)9/h2-4H2,1H3 |
| InChIKey | YWIYEOLSZWMXQG-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.5°C at 760 mmHg (Cal.) |
| Flash point | 91.389°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Dichloromethylsilyl)Butyryl Chloride |