Online Database of Chemicals from Around the World
2-(2,5-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
[CAS# 408492-25-1]
Identification| Name | 2-(2,5-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C12H15BF2O2 |
| Molecular Weight | 240.05 |
| CAS Registry Number | 408492-25-1 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)F |
|
Properties
| Solubility | 160 mg/L (25 °C water) |
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.468, Calc.* |
| Melting point | 55.00 °C |
| Boiling Point | 246.70 °C, 288.0±30.0 °C (760 mmHg), Calc.* |
| Flash Point | 128.0±24.6 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
4-(2,6-Difluoro... N-[(2S,3R)-2-(2... N-[(2R,3R)-2-(2... N-[(2S,3S)-2-(2... N-[(2R,3S)-2-(2... (alphaR)-alpha-... (2R)-1-(2,4-Dif... (2S)-1-(2,4-Dif... (6S,9R)-6-(2,3-... 2-(2,3-Difluoro... 5-(2,6-Difluoro... 5-(2,6-Difluoro... 4-(2,4-Difluoro... 4-(3,4-Difluoro... 2-(2,4-Difluoro... (2,4-Difluoroph... (3,4-Difluoroph... (3,5-Difluoroph... 3,4-Difluoro-2-... (2,4-Difluoroph...