Online Database of Chemicals from Around the World
|
CAS#: 408533-65-3 Product: 1,1,1-Trichloro-3-(2-Pyrimidinyl)-2-Propanol No suppilers available for the product. |
| Name | 1,1,1-Trichloro-3-(2-Pyrimidinyl)-2-Propanol |
|---|---|
| Synonyms | 1,1,1-Trichlor-3-(2-pyrimidinyl)-2-propanol; 1,1,1-Trichloro-3-(2-pyrimidinyl)-2-propanol; 1,1,1-Trichloro-3-(2-pyrimidinyl)-2-propanol |
| Molecular Structure |  |
| Molecular Formula | C7H7Cl3N2O |
| Molecular Weight | 241.50 |
| CAS Registry Number | 408533-65-3 |
| SMILES | c1cnc(nc1)CC(C(Cl)(Cl)Cl)O |
| InChI | 1S/C7H7Cl3N2O/c8-7(9,10)5(13)4-6-11-2-1-3-12-6/h1-3,5,13H,4H2 |
| InChIKey | VUJWYIGJVWAAGR-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.5±42.0°C at 760 mmHg (Cal.) |
| Flash point | 139.8±27.9°C (Cal.) |
| Refractive index | 1.584 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trichloro-3-(2-Pyrimidinyl)-2-Propanol |