Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Phenyl-2,4-Pentadienoic Acid Chloride |
|---|---|
| Synonyms | 2,4-Pentadienoyl Chloride, 5-Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C11H9ClO |
| Molecular Weight | 192.64 |
| CAS Registry Number | 40926-86-1 |
| SMILES | C1=CC=CC=C1/C=C/C=C/C(Cl)=O |
| InChI | 1S/C11H9ClO/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H/b8-4+,9-5+ |
| InChIKey | VBSYMODXUFYOLA-KBXRYBNXSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.082°C at 760 mmHg (Cal.) |
| Flash point | 145.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Phenyl-2,4-Pentadienoic Acid Chloride |