| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 3,4-Dihydro-2H-Pyrano[2,3-b]Quinolin-7-Yl(4-Methoxycyclohexyl)Methanone |
|---|---|
| Synonyms | (3,4-dihy |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.40 |
| CAS Registry Number | 409345-29-5 |
| SMILES | O=C(c3cc2c(nc1OCCCc1c2)cc3)C4CCC(OC)CC4 |
| InChI | 1S/C20H23NO3/c1-23-17-7-4-13(5-8-17)19(22)14-6-9-18-16(11-14)12-15-3-2-10-24-20(15)21-18/h6,9,11-13,17H,2-5,7-8,10H2,1H3 |
| InChIKey | QOTAQTRFJWLFCR-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.507°C at 760 mmHg (Cal.) |
| Flash point | 257.707°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| solubility | Soluble to 100 mM in ethanol and to 25 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-2H-Pyrano[2,3-b]Quinolin-7-Yl(4-Methoxycyclohexyl)Methanone |