Online Database of Chemicals from Around the World
|
CAS#: 40939-03-5 Product: 1-(4-Chlorobenzylthio)Acetone No suppilers available for the product. |
| Name | 1-(4-Chlorobenzylthio)Acetone |
|---|---|
| Synonyms | 1-[(4-Chlorophenyl)Methylthio]Propan-2-One; 1-[(4-Chlorobenzyl)Thio]Acetone; 1-(4-Chlorobenzylthio)Acetone |
| Molecular Structure |  |
| Molecular Formula | C10H11ClOS |
| Molecular Weight | 214.71 |
| CAS Registry Number | 40939-03-5 |
| EINECS | 255-145-4 |
| SMILES | C1=C(Cl)C=CC(=C1)CSCC(=O)C |
| InChI | 1S/C10H11ClOS/c1-8(12)6-13-7-9-2-4-10(11)5-3-9/h2-5H,6-7H2,1H3 |
| InChIKey | JNFWNBVDFWSOQJ-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.126°C at 760 mmHg (Cal.) |
| Flash point | 135.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorobenzylthio)Acetone |