|
CAS#: 4096-72-4 Product: 2,6-Di-Tert-Butyl-4-Chlorophenol No suppilers available for the product. |
| Name | 2,6-Di-Tert-Butyl-4-Chlorophenol |
|---|---|
| Synonyms | 2,6-Ditert-Butyl-4-Chloro-Phenol; Zinc00395032 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21ClO |
| Molecular Weight | 240.77 |
| CAS Registry Number | 4096-72-4 |
| EINECS | 223-851-1 |
| SMILES | C1=C(Cl)C=C(C(=C1C(C)(C)C)O)C(C)(C)C |
| InChI | 1S/C14H21ClO/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,16H,1-6H3 |
| InChIKey | WLQMYDWPKCQDPQ-UHFFFAOYSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.301°C at 760 mmHg (Cal.) |
| Flash point | 113.646°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Di-Tert-Butyl-4-Chlorophenol |