| Guangzhou Lanning Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.lanningbio.net | |||
![]() | +86 15813355568 | |||
![]() | lanningsale@sina.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 15813355568 | |||
![]() | WhatsApp:+8615813355568 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Pseudomonic acid B |
|---|---|
| Synonyms | 9-[(E)-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]but-2-enoyl]oxynonanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C26H44O10 |
| Molecular Weight | 516.62 |
| CAS Registry Number | 40980-51-6 |
| SMILES | C[C@H]([C@H]1[C@@H](O1)C[C@]2(CO[C@H]([C@@H]([C@@H]2O)O)C/C(=C/C(=O)OCCCCCCCCC(=O)O)/C)O)[C@H](C)O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.539, Calc.* |
| Boiling Point | 689.4±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 221.9±25.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Pseudomonic acid B |