Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (5alpha,20S)-Cholestane |
|---|---|
| Synonyms | α,α,α20S-CHOLESTANE |
| Molecular Structure |  |
| Molecular Formula | C27H48 |
| Molecular Weight | 372.67 |
| CAS Registry Number | 41083-75-4 |
| SMILES | C[C@@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CCCC4)C)C |
| InChI | 1S/C27H48/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h19-25H,6-18H2,1-5H3/t20-,21+,22-,23+,24-,25-,26-,27+/m0/s1 |
| InChIKey | XIIAYQZJNBULGD-VANMJNHGSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.9±12.0°C at 760 mmHg (Cal.) |
| Flash point | 210.3±13.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5alpha,20S)-Cholestane |