|
CAS#: 411221-51-7 Product: 5-Cyano-2-(4-Fluorobenzoyl)Benzoic Acid No suppilers available for the product. |
| Name | 5-Cyano-2-(4-Fluorobenzoyl)Benzoic Acid |
|---|---|
| Synonyms | 5-Cyano-2-(4-fluorobenzoyl)benzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H8FNO3 |
| Molecular Weight | 269.23 |
| CAS Registry Number | 411221-51-7 |
| SMILES | c1cc(ccc1C(=O)c2ccc(cc2C(=O)O)C#N)F |
| InChI | 1S/C15H8FNO3/c16-11-4-2-10(3-5-11)14(18)12-6-1-9(8-17)7-13(12)15(19)20/h1-7H,(H,19,20) |
| InChIKey | CXSSLYRYEOIJJZ-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.152°C at 760 mmHg (Cal.) |
| Flash point | 260.516°C (Cal.) |
| Refractive index | 1.63 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Cyano-2-(4-Fluorobenzoyl)Benzoic Acid |