| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Propenoic acid, ethyl ester, polymer with ethene and 2,5-furandione |
|---|---|
| Synonyms | Ethylene; Ethyl Prop-2-Enoate; Furan-2,5-Dione; Ethylene; Furan-2,5-Dione; Prop-2-Enoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 41171-14-6 |
| SMILES | O=C1OC(=O)C=C1.C(OC(=O)C=C)C.C=C |
| InChI | 1S/C5H8O2.C4H2O3.C2H4/c1-3-5(6)7-4-2;5-3-1-2-4(6)7-3;1-2/h3H,1,4H2,2H3;1-2H;1-2H2 |
| InChIKey | GURLTLRQWSAAIX-UHFFFAOYSA-N |
| Boiling point | 99.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 15.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propenoic acid, ethyl ester, polymer with ethene and 2,5-furandione |