Online Database of Chemicals from Around the World
|
CAS#: 41448-29-7 Product: 3,7-Dimethyl-2,6-nonadienal No suppilers available for the product. |
| Name | 3,7-Dimethyl-2,6-nonadienal |
|---|---|
| Synonyms | (2E,6E)-3,7-Dimethylnona-2,6-Dienal; Zinc02006748; 2,6-Nonadien-1-Al, 3,7-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 41448-29-7 |
| EINECS | 255-368-7 |
| SMILES | C(C\C(=C\C=O)C)\C=C(\CC)C |
| InChI | 1S/C11H18O/c1-4-10(2)6-5-7-11(3)8-9-12/h6,8-9H,4-5,7H2,1-3H3/b10-6+,11-8+ |
| InChIKey | BCEQJZNLIKMDEU-NSJFVGFPSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.218°C at 760 mmHg (Cal.) |
| Flash point | 102.053°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dimethyl-2,6-nonadienal |