|
CAS#: 41546-19-4 Product: beta-L-Ribofuranose No suppilers available for the product. |
| Name | beta-L-Ribofuranose |
|---|---|
| Synonyms | (2S,3S,4R,5S)-5-(hydroxymethyl)tetrahydrofuran-2,3,4-triol; β-L-Rib; β-L-ribofuranose |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 41546-19-4 |
| SMILES | O[C@H]1[C@@H](O[C@H](O)[C@H]1O)CO |
| InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5-/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-FCAWWPLPSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.36°C at 760 mmHg (Cal.) |
| Flash point | 180.812°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-L-Ribofuranose |