Online Database of Chemicals from Around the World
|
CAS#: 41593-31-1 Product: 1,2-Dihydrochrysene No suppilers available for the product. |
| Name | 1,2-Dihydrochrysene |
|---|---|
| Synonyms | Chrysene, 1,2-Dihydro-; Chrysene, Dihydro- (9Ci); Dihydrochrysene |
| Molecular Structure |  |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 |
| CAS Registry Number | 41593-31-1 (18930-98-8) |
| SMILES | C2=C3C(=C1C=CC=CC1=C2)C=CC4=C3C=CCC4 |
| InChI | 1S/C18H14/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1,3-5,7-12H,2,6H2 |
| InChIKey | TVOQZJIIVKIKQU-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.768°C at 760 mmHg (Cal.) |
| Flash point | 199.354°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydrochrysene |