Online Database of Chemicals from Around the World
|
CAS#: 41621-32-3 Product: Morindaparvin A No suppilers available for the product. |
| Name | Morindaparvin A |
|---|---|
| Synonyms | Nsc363177; C10374; Nsc 363177 |
| Molecular Structure |  |
| Molecular Formula | C15H8O4 |
| Molecular Weight | 252.23 |
| CAS Registry Number | 41621-32-3 |
| SMILES | C2=CC1=C(OCO1)C3=C2C(=O)C4=C(C3=O)C=CC=C4 |
| InChI | 1S/C15H8O4/c16-13-8-3-1-2-4-9(8)14(17)12-10(13)5-6-11-15(12)19-7-18-11/h1-6H,7H2 |
| InChIKey | YBXYYSSRAZPEGN-UHFFFAOYSA-N |
| Density | 1.482g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.082°C at 760 mmHg (Cal.) |
| Flash point | 222.33°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Morindaparvin A |