Online Database of Chemicals from Around the World
|
CAS#: 41690-66-8 Product: Croalbinecine No suppilers available for the product. |
| Name | Croalbinecine |
|---|---|
| Synonyms | (1R,6R,7R,8R)-7-Methylolpyrrolizidine-1,6-Diol |
| Molecular Structure |  |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 |
| CAS Registry Number | 41690-66-8 |
| SMILES | [C@@H]1(CN2[C@H]([C@@H]1CO)[C@@H](CC2)O)O |
| InChI | 1S/C8H15NO3/c10-4-5-7(12)3-9-2-1-6(11)8(5)9/h5-8,10-12H,1-4H2/t5-,6-,7+,8-/m1/s1 |
| InChIKey | HRBZHPMMNALVKR-OOJXKGFFSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.296°C at 760 mmHg (Cal.) |
| Flash point | 184.292°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Croalbinecine |