Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,4,5-Tetraphenyl-1,5-Pentanedione |
|---|---|
| Synonyms | Nsc358253; 1,2,4,5-Tetraphenyl-1,5-Pentanedione |
| Molecular Structure |  |
| Molecular Formula | C29H24O2 |
| Molecular Weight | 404.51 |
| CAS Registry Number | 41848-69-5 |
| SMILES | C1=CC=CC=C1C(CC(C2=CC=CC=C2)C(C3=CC=CC=C3)=O)C(C4=CC=CC=C4)=O |
| InChI | 1S/C29H24O2/c30-28(24-17-9-3-10-18-24)26(22-13-5-1-6-14-22)21-27(23-15-7-2-8-16-23)29(31)25-19-11-4-12-20-25/h1-20,26-27H,21H2 |
| InChIKey | KPOYPXGVRAXXPN-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.824°C at 760 mmHg (Cal.) |
| Flash point | 212.938°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetraphenyl-1,5-Pentanedione |