Online Database of Chemicals from Around the World
|
CAS#: 41928-02-3 Product: 10-Hydroxyyohimbine No suppilers available for the product. |
| Name | 10-Hydroxyyohimbine |
|---|---|
| Synonyms | Yohimban-16-Carboxylic Acid, 10,17-Dihydroxy-, Methyl Ester, (16Alpha,17Alpha)- |
| Molecular Structure |  |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 |
| CAS Registry Number | 41928-02-3 |
| SMILES | [C@H]34C2=C(C1=CC(=CC=C1[NH]2)O)CCN3C[C@H]5[C@H](C4)[C@@H](C(=O)OC)[C@H](CC5)O |
| InChI | 1S/C21H26N2O4/c1-27-21(26)19-14-9-17-20-13(15-8-12(24)3-4-16(15)22-20)6-7-23(17)10-11(14)2-5-18(19)25/h3-4,8,11,14,17-19,22,24-25H,2,5-7,9-10H2,1H3/t11-,14-,17-,18-,19+/m0/s1 |
| InChIKey | XKJJSWXADRRQKQ-HRHDOCNUSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 591.081°C at 760 mmHg (Cal.) |
| Flash point | 311.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Hydroxyyohimbine |