Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 3,3'-Diamino-4,4'-Biphenyldiol |
|---|---|
| Synonyms | 3,3'-Diamino[1,1'-biphenyl]-4,4'-diol #; 3,3'-diaminobiphenyl-4,4'-diol |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 4194-40-5 |
| SMILES | Oc2ccc(c1ccc(O)c(N)c1)cc2N |
| InChI | 1S/C12H12N2O2/c13-9-5-7(1-3-11(9)15)8-2-4-12(16)10(14)6-8/h1-6,15-16H,13-14H2 |
| InChIKey | KZLDGFZCFRXUIB-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.855°C at 760 mmHg (Cal.) |
| Flash point | 227.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Diamino-4,4'-Biphenyldiol |