| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(2R,3S)-3-Hexyl-2-Oxiranyl]Ethanone |
|---|---|
| Synonyms | 1-((2R,3S)-3-hexyloxiran-2-yl)ethanone; InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O2 |
| CAS Registry Number | 420849-80-5 |
| SMILES | CCCCCC[C@H]1[C@@H](O1)C(=O)C |
| InChI | 1S/C10H18O2/c1-3-4-5-6-7-9-10(12-9)8(2)11/h9-10H,3-7H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | ISBANAVARCNHCE-UWVGGRQHSA-N |
| Refractive index | (Cal.) |
|---|---|
| (1) | Kohji Suda, Kenji Baba, Shin-ichiro Nakajima and Toshikatsu Takanami. High-valent metalloporphyrin, Fe(tpp)OTf, catalyzed rearrangement of a,ß-epoxy ketones into 1,2-diketones, Chem. Commun., 2002, 0, 2570. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[(2R,3S)-3-Hexyl-2-Oxiranyl]Ethanone |