Online Database of Chemicals from Around the World
|
CAS#: 422-26-4 Product: 1,1,1,2,2,3-Hexachloro-3-fluoropropane No suppilers available for the product. |
| Name | 1,1,1,2,2,3-Hexachloro-3-fluoropropane |
|---|---|
| Synonyms | 1,1,1,2,2,3-Hexachloro-3-Fluoro-Propane; Propane, 1,1,1,2,2,3-Hexachloro-3-Fluoro-; Hcfc 221 |
| Molecular Structure |  |
| Molecular Formula | C3HCl6F |
| Molecular Weight | 268.76 |
| CAS Registry Number | 422-26-4 |
| SMILES | C(C(Cl)(C(Cl)(Cl)Cl)Cl)(Cl)F |
| InChI | 1S/C3HCl6F/c4-1(10)2(5,6)3(7,8)9/h1H |
| InChIKey | FVFRHJRSCRWRPY-UHFFFAOYSA-N |
| Density | 1.765g/cm3 (Cal.) |
|---|---|
| Boiling point | 211.09°C at 760 mmHg (Cal.) |
| Flash point | 93.188°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,2,3-Hexachloro-3-fluoropropane |