Online Database of Chemicals from Around the World
|
CAS#: 42242-58-0 Product: 4-(Benzofuran-7-Ylazo)-N,N-Dimethylbenzenamine No suppilers available for the product. |
| Name | 4-(Benzofuran-7-Ylazo)-N,N-Dimethylbenzenamine |
|---|---|
| Synonyms | 4-(Benzofuran-7-Ylazo)-N,N-Dimethyl-Aniline; 4-(7-Benzofuranylazo)-N,N-Dimethylaniline; [4-(Benzofuran-7-Ylazo)Phenyl]-Dimethyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.31 |
| CAS Registry Number | 42242-58-0 |
| SMILES | C1=C(N(C)C)C=CC(=C1)N=NC2=CC=CC3=C2OC=C3 |
| InChI | 1S/C16H15N3O/c1-19(2)14-8-6-13(7-9-14)17-18-15-5-3-4-12-10-11-20-16(12)15/h3-11H,1-2H3 |
| InChIKey | LHVRXAUETJRESN-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.114°C at 760 mmHg (Cal.) |
| Flash point | 211.507°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Benzofuran-7-Ylazo)-N,N-Dimethylbenzenamine |