Online Database of Chemicals from Around the World
|
CAS#: 42242-69-3 Product: 5-Carboxybupranolol No suppilers available for the product. |
| Name | 5-Carboxybupranolol |
|---|---|
| Synonyms | 3-[3-(Tert-Butylamino)-2-Hydroxy-Propoxy]-4-Chloro-Benzoic Acid; 1-Tert-Butylamino-3-(2-Chloro-5-Carboxyphenoxy)Propan-2-Ol; 5-Carboxybupranolol |
| Molecular Structure |  |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 |
| CAS Registry Number | 42242-69-3 |
| SMILES | C1=C(C(=O)O)C=CC(=C1OCC(O)CNC(C)(C)C)Cl |
| InChI | 1S/C14H20ClNO4/c1-14(2,3)16-7-10(17)8-20-12-6-9(13(18)19)4-5-11(12)15/h4-6,10,16-17H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | QNYWJTMYNAJZTQ-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.295°C at 760 mmHg (Cal.) |
| Flash point | 246.693°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Carboxybupranolol |